Recent questions and answers in Physics & Chemistry

37
views
2 answers
Calculate the number of moles in Ti and O and Fe in the question and find its ratio
77
views
1 answers
Referring to the circuit, determine the following
105
views
1 answers
What happens to an incandescent light bulb if it is connected to a current with 400Hz, as opposed to 50Hz or 60Hz, or greater? What happens to the filament?
88
views
1 answers
Three point charges are placed at the corners of an equilateral triangle. Each side of the triangle is of length \(l\). If two charges are positive, each of value \(+Q\),...
75
views
1 answers
How do you determine the mass number of an ion with 47 protons and 62 neutrons?
294
views
1 answers
What is the net charge of an ion that has 47 protons and 46 electrons?
72
views
1 answers
What is the element of an ion with 47 protons?
76
views
1 answers
What species is represented by the following information? protons = 47 neutrons = 62 electrons = 46
96
views
1 answers
Potassium superoxide, \( \mathrm{KO}_{2} \), is used in rebreathing masks for diving to generate oxygen according to the equation:\[4 \mathrm{KO}_{2}(s)+2 \mathrm{H}_{2} ...
109
views
1 answers
Is this true? Inorganic compounds do not contain the element carbon and are not produced by living organisms e.g., water, gases and minerals.
90
views
1 answers
Write the molecular equation of sodium nitrate
94
views
1 answers
What is the empirical formula for ascorbic acid?
137
views
1 answers
Calculate the mass of argon
69
views
1 answers
Do more meteorites strike the earth between the tropics than outside them?
147
views
1 answers
Define gravitational potential energy
147
views
1 answers
What is the formula of sodium oxide?
121
views
1 answers
How likely is it that the observable universe is just a very small fraction of the actual universe?
151
views
1 answers
Demonstrate that the $\chi^{(3)}$ tensor is reduced to a scalar in isotropic material in order to describe four wave mixing.
115
views
1 answers
Consider four-wave mixing in a silicon waveguide and assume the crystallographic axes as your reference frame. Determine the polarization of the generated idler by consid...
116
views
1 answers
Describe the four wave mixing process
154
views
1 answers
Consider four-wave mixing in a silicon waveguide and assume the crystallographic axes as your reference frame. Determine the polarization of the generated idler by consid...
176
views
1 answers
Is silicon an isotropic material? If not, which is its $\chi^{(3)}$ rank tensor? How you can determine the polarization of the Four Wave Mixing generated field?
417
views
1 answers
A skier slides down the frictionless slope as shown. What is the skier's speed at the bottom?Solution:The conservation of energy means that the energy of the skier is sam...
170
views
1 answers
What is a molecule?a) A small particle of dust or sandb) A single atom that makes up everythingc) A group of two or more atoms held together by chemical bondsd) A type of...
178
views
1 answers
Water potential gradient is caused by differences in ...
145
views
1 answers
Are weight and mass the same thing?
140
views
1 answers
State the Lorenz equations
142
views
1 answers
When are two electrical networks said to be dual networks?
194
views
1 answers
Does Ohm's law apply to gas discharge tube?
211
views
2 answers
Explain superconductors like I'm five years old.
127
views
1 answers
With the keywords below, explain the birth, life and death of a star:stellarevolutionnebulaprotostarconstellationnuclear fusionstellar wind
378
views
1 answers
When converting from true course to magnetic heading, a pilot should
245
views
1 answers
Why is disodium salt of edta preferred to edta?
257
views
1 answers
Give the significance of using equal volumes of alcohol and ether in the acid value determination
450
views
1 answers
What is a differential equation model of control system?
290
views
1 answers
Give control system modelling examples
131
views
1 answers
why is kinetic energy not conserved in inelastic collisions where is the energy lost?
168
views
1 answers
why is kinetic energy not conserved in inelastic collisions
135
views
1 answers
is momentum conserved in an elastic collision?
145
views
1 answers
what happens to momentum in collisions?
261
views
1 answers
how is momentum related to acceleration?
319
views
1 answers
How long should I boil eggs?
405
views
1 answers
List the IUPAC Rules for Alkane Nomenclature
524
views
1 answers
How is physics related to chemistry?
246
views
1 answers
<smiles>[Z2]Nc1c(CC([R10])CSC)ncn1CC#C</smiles>
327
views
1 answers
Can quantum physics explain the paranormal world?
487
views
1 answers
How do the different types of intermolecular forces in phosphine (PH3) and ammonia (NH3) affect their evaporation rates? Provide a detailed explanation.
505
views
1 answers
Compare the intermolecular forces present in phosphine (PH3) and ammonia (NH3) and explain why PH3 evaporates faster than NH3.
467
views
1 answers
Give the oxidation number of nitrogen in the following:\[\mathrm{NH4}^{+}\]
To see more, click for all the questions in this category.
This site uses cookies to provide quality services and to analyze traffic. For more information, see the Privacy Policy